C31H29NO2S — CID 135140978
(E)-2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-methylsulfanylethenamine (PubChem CID 135140978) has the molecular formula C31H29NO2S and a molecular weight of 479.65 g/mol. Its IUPAC name is (E)-2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-methylsulfanylethenamine.
| Compound Name | (E)-2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-methylsulfanylethenamine |
|---|---|
| PubChem CID | 135140978 |
| Molecular Formula | C31H29NO2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (E)-2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-methylsulfanylethenamine |
| SMILES | COc1ccc(C(=C(c2ccccc2)c2ccc(/C(=C\N)SC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H29NO2S/c1-33-27-17-13-25(14-18-27)31(26-15-19-28(34-2)20-16-26)30(23-7-5-4-6-8-23)24-11-9-22(10-12-24)29(21-32)35-3/h4-21H,32H2,1-3H3/b29-21+ |
| InChIKey | AXBGZYSFIOAGRX-XHLNEMQHSA-N |
| XLogP | 7.33 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|