C28H25NO3 — CID 121329846
4-[1,2,2-tris(4-methoxyphenyl)ethenyl]pyridine (PubChem CID 121329846) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is 4-[1,2,2-tris(4-methoxyphenyl)ethenyl]pyridine.
| Compound Name | 4-[1,2,2-tris(4-methoxyphenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 121329846 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 4-[1,2,2-tris(4-methoxyphenyl)ethenyl]pyridine |
| SMILES | COc1ccc(C(=C(c2ccc(OC)cc2)c2ccc(OC)cc2)c2ccncc2)cc1 |
| InChI | InChI=1S/C28H25NO3/c1-30-24-10-4-20(5-11-24)27(21-6-12-25(31-2)13-7-21)28(23-16-18-29-19-17-23)22-8-14-26(32-3)15-9-22/h4-19H,1-3H3 |
| InChIKey | GUYBZCYHNBHVQN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|