C54H48N4O4 — CID 101376712
N-(4-methoxyphenyl)-4-[1,2,2-tris[4-(4-methoxyanilino)phenyl]ethenyl]aniline (PubChem CID 101376712) has the molecular formula C54H48N4O4 and a molecular weight of 817.00 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-[1,2,2-tris[4-(4-methoxyanilino)phenyl]ethenyl]aniline.
| Compound Name | N-(4-methoxyphenyl)-4-[1,2,2-tris[4-(4-methoxyanilino)phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 101376712 |
| Molecular Formula | C54H48N4O4 |
| Molecular Weight | 817.00 g/mol |
| Exact Mass | 816.37 |
| IUPAC Name | N-(4-methoxyphenyl)-4-[1,2,2-tris[4-(4-methoxyanilino)phenyl]ethenyl]aniline |
| SMILES | COc1ccc(Nc2ccc(C(=C(c3ccc(Nc4ccc(OC)cc4)cc3)c3ccc(Nc4ccc(OC)cc4)cc3)c3ccc(Nc4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H48N4O4/c1-59-49-29-21-45(22-30-49)55-41-13-5-37(6-14-41)53(38-7-15-42(16-8-38)56-46-23-31-50(60-2)32-24-46)54(39-9-17-43(18-10-39)57-47-25-33-51(61-3)34-26-47)40-11-19-44(20-12-40)58-48-27-35-52(62-4)36-28-48/h5-36,55-58H,1-4H3 |
| InChIKey | WQTTZUAYGVBBEF-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.00 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|