C30H28O2 — CID 58362282
1-[(Z)-1,2-bis(4-methoxyphenyl)-2-(4-methylphenyl)ethenyl]-4-methylbenzene (PubChem CID 58362282) has the molecular formula C30H28O2 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[(Z)-1,2-bis(4-methoxyphenyl)-2-(4-methylphenyl)ethenyl]-4-methylbenzene.
| Compound Name | 1-[(Z)-1,2-bis(4-methoxyphenyl)-2-(4-methylphenyl)ethenyl]-4-methylbenzene |
|---|---|
| PubChem CID | 58362282 |
| Molecular Formula | C30H28O2 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 1-[(Z)-1,2-bis(4-methoxyphenyl)-2-(4-methylphenyl)ethenyl]-4-methylbenzene |
| SMILES | COc1ccc(/C(=C(/c2ccc(C)cc2)c2ccc(OC)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H28O2/c1-21-5-9-23(10-6-21)29(25-13-17-27(31-3)18-14-25)30(24-11-7-22(2)8-12-24)26-15-19-28(32-4)20-16-26/h5-20H,1-4H3/b30-29- |
| InChIKey | JKQCERUTFNGLPE-FLWNBWAVSA-N |
| XLogP | 7.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|