C22H22O — CID 162401228
1-[3,4-dimethylidene-5-(4-methylphenyl)hexa-1,5-dien-2-yl]-4-methoxybenzene (PubChem CID 162401228) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[3,4-dimethylidene-5-(4-methylphenyl)hexa-1,5-dien-2-yl]-4-methoxybenzene.
| Compound Name | 1-[3,4-dimethylidene-5-(4-methylphenyl)hexa-1,5-dien-2-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 162401228 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-[3,4-dimethylidene-5-(4-methylphenyl)hexa-1,5-dien-2-yl]-4-methoxybenzene |
| SMILES | C=C(C(=C)C(=C)c1ccc(OC)cc1)C(=C)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H22O/c1-15-7-9-20(10-8-15)18(4)16(2)17(3)19(5)21-11-13-22(23-6)14-12-21/h7-14H,2-5H2,1,6H3 |
| InChIKey | PMHOWOKPJSGDQZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|