C25H28O — CID 170597875
1-[(Z)-1,2-diphenylbut-1-enyl]-4-methoxybenzene;ethane (PubChem CID 170597875) has the molecular formula C25H28O and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-[(Z)-1,2-diphenylbut-1-enyl]-4-methoxybenzene;ethane.
| Compound Name | 1-[(Z)-1,2-diphenylbut-1-enyl]-4-methoxybenzene;ethane |
|---|---|
| PubChem CID | 170597875 |
| Molecular Formula | C25H28O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(Z)-1,2-diphenylbut-1-enyl]-4-methoxybenzene;ethane |
| SMILES | CC.CC/C(=C(\c1ccccc1)c1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H22O.C2H6/c1-3-22(18-10-6-4-7-11-18)23(19-12-8-5-9-13-19)20-14-16-21(24-2)17-15-20;1-2/h4-17H,3H2,1-2H3;1-2H3/b23-22-; |
| InChIKey | TXWUHHCRPMMATE-YJACDMIVSA-N |
| XLogP | 7.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|