C28H34O4 — CID 143870397
4-[(Z)-1-[4-(2,2-dimethoxyethoxy)phenyl]-2-phenylbut-1-enyl]phenol;ethane (PubChem CID 143870397) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 4-[(Z)-1-[4-(2,2-dimethoxyethoxy)phenyl]-2-phenylbut-1-enyl]phenol;ethane.
| Compound Name | 4-[(Z)-1-[4-(2,2-dimethoxyethoxy)phenyl]-2-phenylbut-1-enyl]phenol;ethane |
|---|---|
| PubChem CID | 143870397 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 4-[(Z)-1-[4-(2,2-dimethoxyethoxy)phenyl]-2-phenylbut-1-enyl]phenol;ethane |
| SMILES | CC.CC/C(=C(\c1ccc(O)cc1)c1ccc(OCC(OC)OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H28O4.C2H6/c1-4-24(19-8-6-5-7-9-19)26(20-10-14-22(27)15-11-20)21-12-16-23(17-13-21)30-18-25(28-2)29-3;1-2/h5-17,25,27H,4,18H2,1-3H3;1-2H3/b26-24-; |
| InChIKey | BFGJLKJLLFOJSD-FSKGQQLBSA-N |
| XLogP | 6.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|