C30H38N2O3S — CID 54446236
N-[2-(diethylamino)ethyl]-N-[3-[2-(4-methoxyphenyl)-1-phenylbut-1-enyl]phenyl]methanesulfonamide (PubChem CID 54446236) has the molecular formula C30H38N2O3S and a molecular weight of 506.71 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-[3-[2-(4-methoxyphenyl)-1-phenylbut-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-[3-[2-(4-methoxyphenyl)-1-phenylbut-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 54446236 |
| Molecular Formula | C30H38N2O3S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-[3-[2-(4-methoxyphenyl)-1-phenylbut-1-enyl]phenyl]methanesulfonamide |
| SMILES | CCC(=C(c1ccccc1)c1cccc(N(CCN(CC)CC)S(C)(=O)=O)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H38N2O3S/c1-6-29(24-17-19-28(35-4)20-18-24)30(25-13-10-9-11-14-25)26-15-12-16-27(23-26)32(36(5,33)34)22-21-31(7-2)8-3/h9-20,23H,6-8,21-22H2,1-5H3 |
| InChIKey | WRSQVDGIICNIMI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|