C26H28O3S — CID 46934876
1-(111C)methoxy-4-[(Z)-2-(4-methylsulfonylphenyl)-1-phenylhex-1-enyl]benzene (PubChem CID 46934876) has the molecular formula C26H28O3S and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-(111C)methoxy-4-[(Z)-2-(4-methylsulfonylphenyl)-1-phenylhex-1-enyl]benzene.
| Compound Name | 1-(111C)methoxy-4-[(Z)-2-(4-methylsulfonylphenyl)-1-phenylhex-1-enyl]benzene |
|---|---|
| PubChem CID | 46934876 |
| Molecular Formula | C26H28O3S |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-(111C)methoxy-4-[(Z)-2-(4-methylsulfonylphenyl)-1-phenylhex-1-enyl]benzene |
| SMILES | CCCC/C(=C(\c1ccccc1)c1ccc(O[11CH3])cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H28O3S/c1-4-5-11-25(20-14-18-24(19-15-20)30(3,27)28)26(21-9-7-6-8-10-21)22-12-16-23(29-2)17-13-22/h6-10,12-19H,4-5,11H2,1-3H3/b26-25-/i2-1 |
| InChIKey | MCTCSZBTSDOEPC-CGYKGYBGSA-N |
| XLogP | 6.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|