C28H30N2OS — CID 118887746
N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]pyrrolidine-1-carbothioamide (PubChem CID 118887746) has the molecular formula C28H30N2OS and a molecular weight of 442.63 g/mol. Its IUPAC name is N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]pyrrolidine-1-carbothioamide.
| Compound Name | N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 118887746 |
| Molecular Formula | C28H30N2OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]pyrrolidine-1-carbothioamide |
| SMILES | COc1ccc(/C(=C(/CCNC(=S)N2CCCC2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2OS/c1-31-25-16-14-24(15-17-25)27(23-12-6-3-7-13-23)26(22-10-4-2-5-11-22)18-19-29-28(32)30-20-8-9-21-30/h2-7,10-17H,8-9,18-21H2,1H3,(H,29,32)/b27-26- |
| InChIKey | RMUIQQVPCIBRDQ-RQZHXJHFSA-N |
| XLogP | 6.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|