C31H34N2O3 — CID 130275872
N'-cyclohexyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide (PubChem CID 130275872) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is N'-cyclohexyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide.
| Compound Name | N'-cyclohexyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide |
|---|---|
| PubChem CID | 130275872 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N'-cyclohexyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide |
| SMILES | COc1ccc(C(=C(CCNC(=O)C(=O)NC2CCCCC2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N2O3/c1-36-27-19-17-25(18-20-27)29(24-13-7-3-8-14-24)28(23-11-5-2-6-12-23)21-22-32-30(34)31(35)33-26-15-9-4-10-16-26/h2-3,5-8,11-14,17-20,26H,4,9-10,15-16,21-22H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | UNTJMBCACWIUSL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|