C32H30OS — CID 158143687
(Z)-7-(4-methoxyphenyl)-1,6,7-triphenylhept-6-ene-2-thione (PubChem CID 158143687) has the molecular formula C32H30OS and a molecular weight of 462.66 g/mol. Its IUPAC name is (Z)-7-(4-methoxyphenyl)-1,6,7-triphenylhept-6-ene-2-thione.
| Compound Name | (Z)-7-(4-methoxyphenyl)-1,6,7-triphenylhept-6-ene-2-thione |
|---|---|
| PubChem CID | 158143687 |
| Molecular Formula | C32H30OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (Z)-7-(4-methoxyphenyl)-1,6,7-triphenylhept-6-ene-2-thione |
| SMILES | COc1ccc(/C(=C(/CCCC(=S)Cc2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30OS/c1-33-29-22-20-28(21-23-29)32(27-16-9-4-10-17-27)31(26-14-7-3-8-15-26)19-11-18-30(34)24-25-12-5-2-6-13-25/h2-10,12-17,20-23H,11,18-19,24H2,1H3/b32-31- |
| InChIKey | YAZHBUJUEKQTDY-MVJHLKBCSA-N |
| XLogP | 8.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|