C32H30N2O3 — CID 130276115
N'-benzyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide (PubChem CID 130276115) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is N'-benzyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide.
| Compound Name | N'-benzyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide |
|---|---|
| PubChem CID | 130276115 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N'-benzyl-N-[4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]oxamide |
| SMILES | COc1ccc(C(=C(CCNC(=O)C(=O)NCc2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N2O3/c1-37-28-19-17-27(18-20-28)30(26-15-9-4-10-16-26)29(25-13-7-3-8-14-25)21-22-33-31(35)32(36)34-23-24-11-5-2-6-12-24/h2-20H,21-23H2,1H3,(H,33,35)(H,34,36) |
| InChIKey | YPRSSAMVWWQNDL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|