C29H30N2O4 — CID 118873019
N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]-2-morpholin-4-yl-2-oxoacetamide (PubChem CID 118873019) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]-2-morpholin-4-yl-2-oxoacetamide.
| Compound Name | N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]-2-morpholin-4-yl-2-oxoacetamide |
|---|---|
| PubChem CID | 118873019 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[(Z)-4-(4-methoxyphenyl)-3,4-diphenylbut-3-enyl]-2-morpholin-4-yl-2-oxoacetamide |
| SMILES | COc1ccc(/C(=C(/CCNC(=O)C(=O)N2CCOCC2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-34-25-14-12-24(13-15-25)27(23-10-6-3-7-11-23)26(22-8-4-2-5-9-22)16-17-30-28(32)29(33)31-18-20-35-21-19-31/h2-15H,16-21H2,1H3,(H,30,32)/b27-26- |
| InChIKey | GBFLXUGVYYLGEO-RQZHXJHFSA-N |
| XLogP | 4.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|