C21H23N3O3S — CID 10548842
N-[C-(4-methoxyphenyl)-N-phenacylcarbonimidoyl]morpholine-4-carbothioamide (PubChem CID 10548842) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[C-(4-methoxyphenyl)-N-phenacylcarbonimidoyl]morpholine-4-carbothioamide.
| Compound Name | N-[C-(4-methoxyphenyl)-N-phenacylcarbonimidoyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 10548842 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[C-(4-methoxyphenyl)-N-phenacylcarbonimidoyl]morpholine-4-carbothioamide |
| SMILES | COc1ccc(/C(=N/CC(=O)c2ccccc2)NC(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-26-18-9-7-17(8-10-18)20(23-21(28)24-11-13-27-14-12-24)22-15-19(25)16-5-3-2-4-6-16/h2-10H,11-15H2,1H3,(H,22,23,28) |
| InChIKey | VPNNEHDBJXZFEX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|