C15H18N4O5S — CID 5367974
methyl 2-[[(morpholine-4-carbothioylamino)-(3-nitrophenyl)methylidene]amino]acetate (PubChem CID 5367974) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is methyl 2-[[(morpholine-4-carbothioylamino)-(3-nitrophenyl)methylidene]amino]acetate.
| Compound Name | methyl 2-[[(morpholine-4-carbothioylamino)-(3-nitrophenyl)methylidene]amino]acetate |
|---|---|
| PubChem CID | 5367974 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | methyl 2-[[(morpholine-4-carbothioylamino)-(3-nitrophenyl)methylidene]amino]acetate |
| SMILES | COC(=O)C/N=C(\NC(=S)N1CCOCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N4O5S/c1-23-13(20)10-16-14(11-3-2-4-12(9-11)19(21)22)17-15(25)18-5-7-24-8-6-18/h2-4,9H,5-8,10H2,1H3,(H,16,17,25) |
| InChIKey | YUSPBBXDNRNQNO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|