C14H17N3O4S — CID 2250350
N-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-3-nitrobenzamide (PubChem CID 2250350) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is N-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-3-nitrobenzamide.
| Compound Name | N-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2250350 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-3-nitrobenzamide |
| SMILES | C[C@@H]1CN(C(=S)NC(=O)c2cccc([N+](=O)[O-])c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C14H17N3O4S/c1-9-7-16(8-10(2)21-9)14(22)15-13(18)11-4-3-5-12(6-11)17(19)20/h3-6,9-10H,7-8H2,1-2H3,(H,15,18,22)/t9-,10-/m1/s1 |
| InChIKey | PGLWMWSPUUOAMJ-NXEZZACHSA-N |
| XLogP | 1.72 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|