C16H22N2O4S — CID 1242393
N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]-3,4-dimethoxybenzamide (PubChem CID 1242393) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1242393 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)N2C[C@H](C)O[C@@H](C)C2)cc1OC |
| InChI | InChI=1S/C16H22N2O4S/c1-10-8-18(9-11(2)22-10)16(23)17-15(19)12-5-6-13(20-3)14(7-12)21-4/h5-7,10-11H,8-9H2,1-4H3,(H,17,19,23)/t10-,11-/m0/s1 |
| InChIKey | XAOXZEXNAMPSNP-QWRGUYRKSA-N |
| XLogP | 1.83 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|