C15H21NO4S — CID 1264364
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-hydroxy-3,5-dimethoxyphenyl)methanethione (PubChem CID 1264364) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-hydroxy-3,5-dimethoxyphenyl)methanethione.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-hydroxy-3,5-dimethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 1264364 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-hydroxy-3,5-dimethoxyphenyl)methanethione |
| SMILES | COc1cc(C(=S)N2C[C@@H](C)O[C@@H](C)C2)cc(OC)c1O |
| InChI | InChI=1S/C15H21NO4S/c1-9-7-16(8-10(2)20-9)15(21)11-5-12(18-3)14(17)13(6-11)19-4/h5-6,9-10,17H,7-8H2,1-4H3/t9-,10+ |
| InChIKey | XTLIXCCIRRUDMQ-AOOOYVTPSA-N |
| XLogP | 2.19 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|