C12H15NO4S — CID 3054041
(3,4-dihydroxy-5-methoxyphenyl)-morpholin-4-ylmethanethione (PubChem CID 3054041) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (3,4-dihydroxy-5-methoxyphenyl)-morpholin-4-ylmethanethione.
| Compound Name | (3,4-dihydroxy-5-methoxyphenyl)-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 3054041 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (3,4-dihydroxy-5-methoxyphenyl)-morpholin-4-ylmethanethione |
| SMILES | COc1cc(C(=S)N2CCOCC2)cc(O)c1O |
| InChI | InChI=1S/C12H15NO4S/c1-16-10-7-8(6-9(14)11(10)15)12(18)13-2-4-17-5-3-13/h6-7,14-15H,2-5H2,1H3 |
| InChIKey | JQMKUHHFZBNNPK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|