C11H11I2NO2S — CID 137172624
(4-hydroxy-3,5-diiodophenyl)-morpholin-4-ylmethanethione (PubChem CID 137172624) has the molecular formula C11H11I2NO2S and a molecular weight of 475.09 g/mol. Its IUPAC name is (4-hydroxy-3,5-diiodophenyl)-morpholin-4-ylmethanethione.
| Compound Name | (4-hydroxy-3,5-diiodophenyl)-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 137172624 |
| Molecular Formula | C11H11I2NO2S |
| Molecular Weight | 475.09 g/mol |
| Exact Mass | 474.86 |
| IUPAC Name | (4-hydroxy-3,5-diiodophenyl)-morpholin-4-ylmethanethione |
| SMILES | Oc1c(I)cc(C(=S)N2CCOCC2)cc1I |
| InChI | InChI=1S/C11H11I2NO2S/c12-8-5-7(6-9(13)10(8)15)11(17)14-1-3-16-4-2-14/h5-6,15H,1-4H2 |
| InChIKey | FRMHXNSZPOXYOI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.09 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|