C14H19NO4S — CID 975910
morpholin-4-yl-(2,4,5-trimethoxyphenyl)methanethione (PubChem CID 975910) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is morpholin-4-yl-(2,4,5-trimethoxyphenyl)methanethione.
| Compound Name | morpholin-4-yl-(2,4,5-trimethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 975910 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | morpholin-4-yl-(2,4,5-trimethoxyphenyl)methanethione |
| SMILES | COc1cc(OC)c(C(=S)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C14H19NO4S/c1-16-11-9-13(18-3)12(17-2)8-10(11)14(20)15-4-6-19-7-5-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | MZGDFUHFLJHIPY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|