C12H13Cl2NO2S — CID 3274273
(3,5-dichloro-2-methoxyphenyl)-morpholin-4-ylmethanethione (PubChem CID 3274273) has the molecular formula C12H13Cl2NO2S and a molecular weight of 306.21 g/mol. Its IUPAC name is (3,5-dichloro-2-methoxyphenyl)-morpholin-4-ylmethanethione.
| Compound Name | (3,5-dichloro-2-methoxyphenyl)-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 3274273 |
| Molecular Formula | C12H13Cl2NO2S |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | (3,5-dichloro-2-methoxyphenyl)-morpholin-4-ylmethanethione |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=S)N1CCOCC1 |
| InChI | InChI=1S/C12H13Cl2NO2S/c1-16-11-9(6-8(13)7-10(11)14)12(18)15-2-4-17-5-3-15/h6-7H,2-5H2,1H3 |
| InChIKey | HIYDHDGWSGWZJK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|