C19H14Cl2F5N3O2S — CID 17112069
3,5-dichloro-2-methoxy-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide (PubChem CID 17112069) has the molecular formula C19H14Cl2F5N3O2S and a molecular weight of 514.30 g/mol. Its IUPAC name is 3,5-dichloro-2-methoxy-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide.
| Compound Name | 3,5-dichloro-2-methoxy-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 17112069 |
| Molecular Formula | C19H14Cl2F5N3O2S |
| Molecular Weight | 514.30 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | 3,5-dichloro-2-methoxy-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)N1CCN(c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H14Cl2F5N3O2S/c1-31-17-9(6-8(20)7-10(17)21)18(30)27-19(32)29-4-2-28(3-5-29)16-14(25)12(23)11(22)13(24)15(16)26/h6-7H,2-5H2,1H3,(H,27,30,32) |
| InChIKey | DDQLWGBZRIWHTL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|