C18H13F5IN3OS — CID 17314165
2-iodo-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide (PubChem CID 17314165) has the molecular formula C18H13F5IN3OS and a molecular weight of 541.28 g/mol. Its IUPAC name is 2-iodo-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide.
| Compound Name | 2-iodo-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 17314165 |
| Molecular Formula | C18H13F5IN3OS |
| Molecular Weight | 541.28 g/mol |
| Exact Mass | 540.97 |
| IUPAC Name | 2-iodo-N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]benzamide |
| SMILES | O=C(NC(=S)N1CCN(c2c(F)c(F)c(F)c(F)c2F)CC1)c1ccccc1I |
| InChI | InChI=1S/C18H13F5IN3OS/c19-11-12(20)14(22)16(15(23)13(11)21)26-5-7-27(8-6-26)18(29)25-17(28)9-3-1-2-4-10(9)24/h1-4H,5-8H2,(H,25,28,29) |
| InChIKey | SESHUUURUYOPRQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|