C25H20F5N3OS — CID 3763434
N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]-2,2-diphenylacetamide (PubChem CID 3763434) has the molecular formula C25H20F5N3OS and a molecular weight of 505.51 g/mol. Its IUPAC name is N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3763434 |
| Molecular Formula | C25H20F5N3OS |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | N-[4-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carbothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)N1CCN(c2c(F)c(F)c(F)c(F)c2F)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20F5N3OS/c26-18-19(27)21(29)23(22(30)20(18)28)32-11-13-33(14-12-32)25(35)31-24(34)17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,31,34,35) |
| InChIKey | DLMLWBVWIVEHSC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|