C24H22F2N2O — CID 113081241
1-[4-(2,6-difluorophenyl)piperazin-1-yl]-2,2-diphenylethanone (PubChem CID 113081241) has the molecular formula C24H22F2N2O and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-[4-(2,6-difluorophenyl)piperazin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(2,6-difluorophenyl)piperazin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 113081241 |
| Molecular Formula | C24H22F2N2O |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[4-(2,6-difluorophenyl)piperazin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCN(c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C24H22F2N2O/c25-20-12-7-13-21(26)23(20)27-14-16-28(17-15-27)24(29)22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-13,22H,14-17H2 |
| InChIKey | PUZXPYNUMSPAAM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |