C19H20IN3OS — CID 17175927
3-iodo-4-methyl-N-(4-phenylpiperazine-1-carbothioyl)benzamide (PubChem CID 17175927) has the molecular formula C19H20IN3OS and a molecular weight of 465.36 g/mol. Its IUPAC name is 3-iodo-4-methyl-N-(4-phenylpiperazine-1-carbothioyl)benzamide.
| Compound Name | 3-iodo-4-methyl-N-(4-phenylpiperazine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 17175927 |
| Molecular Formula | C19H20IN3OS |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 3-iodo-4-methyl-N-(4-phenylpiperazine-1-carbothioyl)benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)N2CCN(c3ccccc3)CC2)cc1I |
| InChI | InChI=1S/C19H20IN3OS/c1-14-7-8-15(13-17(14)20)18(24)21-19(25)23-11-9-22(10-12-23)16-5-3-2-4-6-16/h2-8,13H,9-12H2,1H3,(H,21,24,25) |
| InChIKey | LFFPSMYXZUEGIA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|