C26H26BrN3OS — CID 4945699
N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-methylbenzamide (PubChem CID 4945699) has the molecular formula C26H26BrN3OS and a molecular weight of 508.49 g/mol. Its IUPAC name is N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-methylbenzamide.
| Compound Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-methylbenzamide |
|---|---|
| PubChem CID | 4945699 |
| Molecular Formula | C26H26BrN3OS |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-3-bromo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C26H26BrN3OS/c1-19-12-13-22(18-23(19)27)25(31)28-26(32)30-16-14-29(15-17-30)24(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,18,24H,14-17H2,1H3,(H,28,31,32) |
| InChIKey | YJSJEKFVLOBRBA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|