C31H36BrN3O2S — CID 17343749
N-(4-benzhydrylpiperazine-1-carbothioyl)-5-bromo-2-hexoxybenzamide (PubChem CID 17343749) has the molecular formula C31H36BrN3O2S and a molecular weight of 594.62 g/mol. Its IUPAC name is N-(4-benzhydrylpiperazine-1-carbothioyl)-5-bromo-2-hexoxybenzamide.
| Compound Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-5-bromo-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17343749 |
| Molecular Formula | C31H36BrN3O2S |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | N-(4-benzhydrylpiperazine-1-carbothioyl)-5-bromo-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NC(=S)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H36BrN3O2S/c1-2-3-4-11-22-37-28-17-16-26(32)23-27(28)30(36)33-31(38)35-20-18-34(19-21-35)29(24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-10,12-17,23,29H,2-4,11,18-22H2,1H3,(H,33,36,38) |
| InChIKey | IQFPTTXQQWISOU-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|