C26H26BrN3O3S — CID 17350572
5-bromo-2-butoxy-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]benzamide (PubChem CID 17350572) has the molecular formula C26H26BrN3O3S and a molecular weight of 540.48 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17350572 |
| Molecular Formula | C26H26BrN3O3S |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 5-bromo-2-butoxy-N-[[(2,2-diphenylacetyl)amino]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26BrN3O3S/c1-2-3-16-33-22-15-14-20(27)17-21(22)24(31)28-26(34)30-29-25(32)23(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15,17,23H,2-3,16H2,1H3,(H,29,32)(H2,28,30,31,34) |
| InChIKey | OUGNPWRODCRLGQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|