C30H27N3O3S — CID 19628600
N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 19628600) has the molecular formula C30H27N3O3S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 19628600 |
| Molecular Formula | C30H27N3O3S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)NNC(=O)C(c1ccccc1)c1ccccc1)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C30H27N3O3S/c34-28(25-18-10-11-19-26(25)36-21-20-22-12-4-1-5-13-22)31-30(37)33-32-29(35)27(23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-19,27H,20-21H2,(H,32,35)(H2,31,33,34,37) |
| InChIKey | DJBQJCJLRJYNAI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|