C22H18IN3O2S — CID 3523057
N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-iodobenzamide (PubChem CID 3523057) has the molecular formula C22H18IN3O2S and a molecular weight of 515.38 g/mol. Its IUPAC name is N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 3523057 |
| Molecular Formula | C22H18IN3O2S |
| Molecular Weight | 515.38 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | N-[[(2,2-diphenylacetyl)amino]carbamothioyl]-2-iodobenzamide |
| SMILES | O=C(NC(=S)NNC(=O)C(c1ccccc1)c1ccccc1)c1ccccc1I |
| InChI | InChI=1S/C22H18IN3O2S/c23-18-14-8-7-13-17(18)20(27)24-22(29)26-25-21(28)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H,(H,25,28)(H2,24,26,27,29) |
| InChIKey | GNZFHMRETBLKQT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|