C15H15N3OS — CID 12636581
[(2,2-diphenylacetyl)amino]thiourea (PubChem CID 12636581) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is [(2,2-diphenylacetyl)amino]thiourea.
| Compound Name | [(2,2-diphenylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 12636581 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | [(2,2-diphenylacetyl)amino]thiourea |
| SMILES | NC(=S)NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3OS/c16-15(20)18-17-14(19)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,17,19)(H3,16,18,20) |
| InChIKey | HXLWJZIWRGKFGL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|