C34H34N4O4 — CID 3770806
1-N',6-N'-bis(2,2-diphenylacetyl)hexanedihydrazide (PubChem CID 3770806) has the molecular formula C34H34N4O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is 1-N',6-N'-bis(2,2-diphenylacetyl)hexanedihydrazide.
| Compound Name | 1-N',6-N'-bis(2,2-diphenylacetyl)hexanedihydrazide |
|---|---|
| PubChem CID | 3770806 |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 1-N',6-N'-bis(2,2-diphenylacetyl)hexanedihydrazide |
| SMILES | O=C(CCCCC(=O)NNC(=O)C(c1ccccc1)c1ccccc1)NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34N4O4/c39-29(35-37-33(41)31(25-15-5-1-6-16-25)26-17-7-2-8-18-26)23-13-14-24-30(40)36-38-34(42)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22,31-32H,13-14,23-24H2,(H,35,39)(H,36,40)(H,37,41)(H,38,42) |
| InChIKey | NLFKFCHCNCCCDB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|