About N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide
N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide (PubChem CID 9077513) has the molecular formula C21H19N3O3
and a molecular weight of 361.40 g/mol. Its IUPAC name is N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide.
Molecular Properties
| Compound Name | N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide |
| PubChem CID | 9077513 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide |
| SMILES | O=C(Cn1ccccc1=O)NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N3O3/c25-18(15-24-14-8-7-13-19(24)26)22-23-21(27)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,20H,15H2,(H,22,25)(H,23,27) |
| InChIKey | YSQCQZPMIUJWEG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide?
The IUPAC name of N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide (CID 9077513) is N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide.
What is the SMILES notation for N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide?
The canonical SMILES for N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide is O=C(Cn1ccccc1=O)NNC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide?
The InChIKey is YSQCQZPMIUJWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O3/c25-18(15-24-14-8-7-13-19(24)26)22-23-21(27)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,20H,15H2,(H,22,25)(H,23,27).
What are the key properties of N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide?
N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide has a molecular weight of 361.40 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-oxo-1-pyridinyl)acetyl]-2,2-diphenylacetohydrazide is sourced from PubChem (CID 9077513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).