C22H19FN2O2S — CID 9418013
N'-[2-(2-fluorophenyl)sulfanylacetyl]-2,2-diphenylacetohydrazide (PubChem CID 9418013) has the molecular formula C22H19FN2O2S and a molecular weight of 394.47 g/mol. Its IUPAC name is N'-[2-(2-fluorophenyl)sulfanylacetyl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 9418013 |
| Molecular Formula | C22H19FN2O2S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-2,2-diphenylacetohydrazide |
| SMILES | O=C(CSc1ccccc1F)NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19FN2O2S/c23-18-13-7-8-14-19(18)28-15-20(26)24-25-22(27)21(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,21H,15H2,(H,24,26)(H,25,27) |
| InChIKey | RDCOABQHSPKOFJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|