C16H24FNOS — CID 102914295
2-(2-fluorophenyl)sulfanyl-N-(3-methyl-2-propan-2-ylbutyl)acetamide (PubChem CID 102914295) has the molecular formula C16H24FNOS and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-(3-methyl-2-propan-2-ylbutyl)acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-(3-methyl-2-propan-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 102914295 |
| Molecular Formula | C16H24FNOS |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-(3-methyl-2-propan-2-ylbutyl)acetamide |
| SMILES | CC(C)C(CNC(=O)CSc1ccccc1F)C(C)C |
| InChI | InChI=1S/C16H24FNOS/c1-11(2)13(12(3)4)9-18-16(19)10-20-15-8-6-5-7-14(15)17/h5-8,11-13H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | VJKWCRCAAXMPCH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |