C18H20F2N2OS — CID 55370053
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 55370053) has the molecular formula C18H20F2N2OS and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 55370053 |
| Molecular Formula | C18H20F2N2OS |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | CN(C)C(CNC(=O)CSc1ccccc1F)c1cccc(F)c1 |
| InChI | InChI=1S/C18H20F2N2OS/c1-22(2)16(13-6-5-7-14(19)10-13)11-21-18(23)12-24-17-9-4-3-8-15(17)20/h3-10,16H,11-12H2,1-2H3,(H,21,23) |
| InChIKey | LXNAJPHIPSCGRI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |