C19H23FN2O2 — CID 134057323
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(2-hydroxyphenyl)propanamide (PubChem CID 134057323) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(2-hydroxyphenyl)propanamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 134057323 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-(2-hydroxyphenyl)propanamide |
| SMILES | CN(C)C(CNC(=O)CCc1ccccc1O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN2O2/c1-22(2)17(15-7-5-8-16(20)12-15)13-21-19(24)11-10-14-6-3-4-9-18(14)23/h3-9,12,17,23H,10-11,13H2,1-2H3,(H,21,24) |
| InChIKey | NTHPYDPSLIKTSL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |