C21H27FN4O2 — CID 24640092
3-(benzylcarbamoylamino)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]propanamide (PubChem CID 24640092) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-(benzylcarbamoylamino)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(benzylcarbamoylamino)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 24640092 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-(benzylcarbamoylamino)-N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]propanamide |
| SMILES | CN(C)C(CNC(=O)CCNC(=O)NCc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H27FN4O2/c1-26(2)19(17-9-6-10-18(22)13-17)15-24-20(27)11-12-23-21(28)25-14-16-7-4-3-5-8-16/h3-10,13,19H,11-12,14-15H2,1-2H3,(H,24,27)(H2,23,25,28) |
| InChIKey | HKBRDWRKYMDSGP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |