C19H20F4N2O — CID 34964617
N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 34964617) has the molecular formula C19H20F4N2O and a molecular weight of 368.37 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 34964617 |
| Molecular Formula | C19H20F4N2O |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(C)[C@H](CNC(=O)Cc1cccc(C(F)(F)F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H20F4N2O/c1-25(2)17(14-6-4-8-16(20)11-14)12-24-18(26)10-13-5-3-7-15(9-13)19(21,22)23/h3-9,11,17H,10,12H2,1-2H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | KMARFWVFCBSPCP-QGZVFWFLSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |