C17H17F3N2O — CID 51186638
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2,4-difluorobenzamide (PubChem CID 51186638) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51186638 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2,4-difluorobenzamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(F)cc1F)c1cccc(F)c1 |
| InChI | InChI=1S/C17H17F3N2O/c1-22(2)16(11-4-3-5-12(18)8-11)10-21-17(23)14-7-6-13(19)9-15(14)20/h3-9,16H,10H2,1-2H3,(H,21,23) |
| InChIKey | WFLHNEGCFWRJDY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |