C22H26FN3O2 — CID 51251239
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 51251239) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 51251239 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | CN(C)C(CNC(=O)Cc1ccc(N2CCCC2=O)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FN3O2/c1-25(2)20(17-5-3-6-18(23)14-17)15-24-21(27)13-16-8-10-19(11-9-16)26-12-4-7-22(26)28/h3,5-6,8-11,14,20H,4,7,12-13,15H2,1-2H3,(H,24,27) |
| InChIKey | QJMSPKWIAGLZAI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |