C17H17F4N3O — CID 46522445
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 46522445) has the molecular formula C17H17F4N3O and a molecular weight of 355.34 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46522445 |
| Molecular Formula | C17H17F4N3O |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(C(F)(F)F)nc1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H17F4N3O/c1-24(2)14(11-4-3-5-13(18)8-11)10-23-16(25)12-6-7-15(22-9-12)17(19,20)21/h3-9,14H,10H2,1-2H3,(H,23,25) |
| InChIKey | CPYSVQXRECRMHN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |