C21H23FN4O — CID 46522469
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide (PubChem CID 46522469) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46522469 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(5-methylpyrazol-1-yl)benzamide |
| SMILES | Cc1ccnn1-c1ccc(C(=O)NCC(c2cccc(F)c2)N(C)C)cc1 |
| InChI | InChI=1S/C21H23FN4O/c1-15-11-12-24-26(15)19-9-7-16(8-10-19)21(27)23-14-20(25(2)3)17-5-4-6-18(22)13-17/h4-13,20H,14H2,1-3H3,(H,23,27) |
| InChIKey | QBLIFHUUGXDSKO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |