C18H19FN4O5 — CID 78778000
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-methyl-3,5-dinitrobenzamide (PubChem CID 78778000) has the molecular formula C18H19FN4O5 and a molecular weight of 390.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-methyl-3,5-dinitrobenzamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 78778000 |
| Molecular Formula | C18H19FN4O5 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)NCC(c2cccc(F)c2)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19FN4O5/c1-11-15(22(25)26)8-13(9-16(11)23(27)28)18(24)20-10-17(21(2)3)12-5-4-6-14(19)7-12/h4-9,17H,10H2,1-3H3,(H,20,24) |
| InChIKey | DTYWUSANESCCMY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|