C17H16F3N3O3 — CID 110312851
N-[2-(dimethylamino)-2-phenylethyl]-2,3,4-trifluoro-5-nitrobenzamide (PubChem CID 110312851) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-2,3,4-trifluoro-5-nitrobenzamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-2,3,4-trifluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 110312851 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-2,3,4-trifluoro-5-nitrobenzamide |
| SMILES | CN(C)C(CNC(=O)c1cc([N+](=O)[O-])c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-22(2)13(10-6-4-3-5-7-10)9-21-17(24)11-8-12(23(25)26)15(19)16(20)14(11)18/h3-8,13H,9H2,1-2H3,(H,21,24) |
| InChIKey | XWOXWGJXYUDENW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|