C19H18F3N3O3 — CID 110312897
2,3,4-trifluoro-5-nitro-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 110312897) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 2,3,4-trifluoro-5-nitro-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2,3,4-trifluoro-5-nitro-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 110312897 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2,3,4-trifluoro-5-nitro-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NCC(c1ccccc1)N1CCCC1)c1cc([N+](=O)[O-])c(F)c(F)c1F |
| InChI | InChI=1S/C19H18F3N3O3/c20-16-13(10-14(25(27)28)17(21)18(16)22)19(26)23-11-15(24-8-4-5-9-24)12-6-2-1-3-7-12/h1-3,6-7,10,15H,4-5,8-9,11H2,(H,23,26) |
| InChIKey | BIGPKICUHJQHRB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|