C19H22FN3O — CID 99973037
3-fluoro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]pyridine-4-carboxamide (PubChem CID 99973037) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is 3-fluoro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 99973037 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-fluoro-N-[(2S)-2-phenyl-2-piperidin-1-ylethyl]pyridine-4-carboxamide |
| SMILES | O=C(NC[C@H](c1ccccc1)N1CCCCC1)c1ccncc1F |
| InChI | InChI=1S/C19H22FN3O/c20-17-13-21-10-9-16(17)19(24)22-14-18(15-7-3-1-4-8-15)23-11-5-2-6-12-23/h1,3-4,7-10,13,18H,2,5-6,11-12,14H2,(H,22,24)/t18-/m1/s1 |
| InChIKey | IDRJTHGMNVMJNF-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |